C17H22N2O10S — CID 72547515
[(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-[4-(prop-2-enoylamino)phenoxy]oxan-2-yl]methyl hydrogen sulfate (PubChem CID 72547515) has the molecular formula C17H22N2O10S and a molecular weight of 446.43 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-[4-(prop-2-enoylamino)phenoxy]oxan-2-yl]methyl hydrogen sulfate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-[4-(prop-2-enoylamino)phenoxy]oxan-2-yl]methyl hydrogen sulfate |
|---|---|
| PubChem CID | 72547515 |
| Molecular Formula | C17H22N2O10S |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-3,4-dihydroxy-6-[4-(prop-2-enoylamino)phenoxy]oxan-2-yl]methyl hydrogen sulfate |
| SMILES | C=CC(=O)Nc1ccc(O[C@@H]2O[C@H](COS(=O)(=O)O)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C17H22N2O10S/c1-3-13(21)19-10-4-6-11(7-5-10)28-17-14(18-9(2)20)16(23)15(22)12(29-17)8-27-30(24,25)26/h3-7,12,14-17,22-23H,1,8H2,2H3,(H,18,20)(H,19,21)(H,24,25,26)/t12-,14-,15-,16-,17-/m1/s1 |
| InChIKey | PGLCZSVEMIGDQW-LMHBHQSJSA-N |
| XLogP | -1.04 |
| TPSA | 180.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|