methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid

C8H12N2O4 — CID 134814307

IUPACmethane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid
SMILESC.Cc1cn(CC(=O)O)c(=O)[nH]c1=O
InChIInChI=1S/C7H8N2O4.CH4/c1-4-2-9(3-5(10)11)7(13)8-6(4)12;/h2H,3H2,1H3,(H,10,11)(H,8,12,13);1H4
InChIKeyMUBLINLFYQCHTG-UHFFFAOYSA-N
MW200.19 g/mol
LogP-0.43
Rot. Bonds2

About methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid

methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid (PubChem CID 134814307) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid.

Molecular Properties

Compound Namemethane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid
PubChem CID134814307
Molecular FormulaC8H12N2O4
Molecular Weight200.19 g/mol
Exact Mass200.08
IUPAC Namemethane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid
SMILESC.Cc1cn(CC(=O)O)c(=O)[nH]c1=O
InChIInChI=1S/C7H8N2O4.CH4/c1-4-2-9(3-5(10)11)7(13)8-6(4)12;/h2H,3H2,1H3,(H,10,11)(H,8,12,13);1H4
InChIKeyMUBLINLFYQCHTG-UHFFFAOYSA-N
XLogP-0.43
TPSA92.16 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.19
LogP ≤ 5-0.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid?
The IUPAC name of methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid (CID 134814307) is methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid.
What is the SMILES notation for methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid?
The canonical SMILES for methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid is C.Cc1cn(CC(=O)O)c(=O)[nH]c1=O.
What is the InChIKey of methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid?
The InChIKey is MUBLINLFYQCHTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4.CH4/c1-4-2-9(3-5(10)11)7(13)8-6(4)12;/h2H,3H2,1H3,(H,10,11)(H,8,12,13);1H4.
What are the key properties of methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid?
methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid has a molecular weight of 200.19 g/mol, XLogP of -0.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-(5-methyl-2,4-dioxopyrimidin-1-yl)acetic acid is sourced from PubChem (CID 134814307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).