C14H9ClF3N5 — CID 134815190
N-(4-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine (PubChem CID 134815190) has the molecular formula C14H9ClF3N5 and a molecular weight of 339.71 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine.
| Compound Name | N-(4-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 134815190 |
| Molecular Formula | C14H9ClF3N5 |
| Molecular Weight | 339.71 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-(4-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]tetrazol-5-amine |
| SMILES | FC(F)(F)c1cccc(-n2nnnc2Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C14H9ClF3N5/c15-10-4-6-11(7-5-10)19-13-20-21-22-23(13)12-3-1-2-9(8-12)14(16,17)18/h1-8H,(H,19,20,22) |
| InChIKey | YGUSAXZQBIGTIR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |