C14H12ClN5 — CID 2499898
N-[(3-chlorophenyl)methyl]-1-phenyltetrazol-5-amine (PubChem CID 2499898) has the molecular formula C14H12ClN5 and a molecular weight of 285.74 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 2499898 |
| Molecular Formula | C14H12ClN5 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-1-phenyltetrazol-5-amine |
| SMILES | Clc1cccc(CNc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C14H12ClN5/c15-12-6-4-5-11(9-12)10-16-14-17-18-19-20(14)13-7-2-1-3-8-13/h1-9H,10H2,(H,16,17,19) |
| InChIKey | FYHSQIKEGGXVMU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |