C15H13Cl2N5 — CID 11652890
1-(2,3-dichlorophenyl)-N-[(2-methylphenyl)methyl]tetrazol-5-amine (PubChem CID 11652890) has the molecular formula C15H13Cl2N5 and a molecular weight of 334.21 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-[(2-methylphenyl)methyl]tetrazol-5-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-[(2-methylphenyl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 11652890 |
| Molecular Formula | C15H13Cl2N5 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-[(2-methylphenyl)methyl]tetrazol-5-amine |
| SMILES | Cc1ccccc1CNc1nnnn1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H13Cl2N5/c1-10-5-2-3-6-11(10)9-18-15-19-20-21-22(15)13-8-4-7-12(16)14(13)17/h2-8H,9H2,1H3,(H,18,19,21) |
| InChIKey | XWSYNDMQNWWNGQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |