C14H10Cl2FN5 — CID 54580660
1-(2,3-dichlorophenyl)-N-[(3-fluorophenyl)methyl]tetrazol-5-amine (PubChem CID 54580660) has the molecular formula C14H10Cl2FN5 and a molecular weight of 338.17 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-[(3-fluorophenyl)methyl]tetrazol-5-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-[(3-fluorophenyl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 54580660 |
| Molecular Formula | C14H10Cl2FN5 |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-[(3-fluorophenyl)methyl]tetrazol-5-amine |
| SMILES | Fc1cccc(CNc2nnnn2-c2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2FN5/c15-11-5-2-6-12(13(11)16)22-14(19-20-21-22)18-8-9-3-1-4-10(17)7-9/h1-7H,8H2,(H,18,19,21) |
| InChIKey | IWVBHQLYFBZWHL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |