C15H13Cl2NO4S — CID 134815303
(4-methoxyphenyl)sulfonyl 2-(3,5-dichlorophenyl)ethanimidate (PubChem CID 134815303) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is (4-methoxyphenyl)sulfonyl 2-(3,5-dichlorophenyl)ethanimidate.
| Compound Name | (4-methoxyphenyl)sulfonyl 2-(3,5-dichlorophenyl)ethanimidate |
|---|---|
| PubChem CID | 134815303 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | (4-methoxyphenyl)sulfonyl 2-(3,5-dichlorophenyl)ethanimidate |
| SMILES | [H]/N=C(\Cc1cc(Cl)cc(Cl)c1)OS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-21-13-2-4-14(5-3-13)23(19,20)22-15(18)8-10-6-11(16)9-12(17)7-10/h2-7,9,18H,8H2,1H3/b18-15+ |
| InChIKey | QKAMJWMAZWPIIW-OBGWFSINSA-N |
| XLogP | 3.93 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|