C14H11Cl2NO3S — CID 135079024
(NE)-N-[(2,6-dichlorophenyl)methylidene]-4-methoxybenzenesulfonamide (PubChem CID 135079024) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is (NE)-N-[(2,6-dichlorophenyl)methylidene]-4-methoxybenzenesulfonamide.
| Compound Name | (NE)-N-[(2,6-dichlorophenyl)methylidene]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 135079024 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | (NE)-N-[(2,6-dichlorophenyl)methylidene]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)/N=C/c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c1-20-10-5-7-11(8-6-10)21(18,19)17-9-12-13(15)3-2-4-14(12)16/h2-9H,1H3/b17-9+ |
| InChIKey | CUUUEYUDYSXHJR-RQZCQDPDSA-N |
| XLogP | 3.81 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|