C18H19N5O4 — CID 134815924
3-[3-(dihydroxyamino)-1,2,4-triazol-1-yl]-N-(3-phenylmethoxyphenyl)propanamide (PubChem CID 134815924) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 3-[3-(dihydroxyamino)-1,2,4-triazol-1-yl]-N-(3-phenylmethoxyphenyl)propanamide.
| Compound Name | 3-[3-(dihydroxyamino)-1,2,4-triazol-1-yl]-N-(3-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 134815924 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 3-[3-(dihydroxyamino)-1,2,4-triazol-1-yl]-N-(3-phenylmethoxyphenyl)propanamide |
| SMILES | O=C(CCn1cnc(N(O)O)n1)Nc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19N5O4/c24-17(9-10-22-13-19-18(21-22)23(25)26)20-15-7-4-8-16(11-15)27-12-14-5-2-1-3-6-14/h1-8,11,13,25-26H,9-10,12H2,(H,20,24) |
| InChIKey | LMXOWAULZKNFQZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|