C21H26N4 — CID 134817499
5,5-dimethyl-8-(1-piperidin-4-ylethenyl)-6H-benzo[h]quinazolin-4-amine (PubChem CID 134817499) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is 5,5-dimethyl-8-(1-piperidin-4-ylethenyl)-6H-benzo[h]quinazolin-4-amine.
| Compound Name | 5,5-dimethyl-8-(1-piperidin-4-ylethenyl)-6H-benzo[h]quinazolin-4-amine |
|---|---|
| PubChem CID | 134817499 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 5,5-dimethyl-8-(1-piperidin-4-ylethenyl)-6H-benzo[h]quinazolin-4-amine |
| SMILES | C=C(c1ccc2c(c1)CC(C)(C)c1c(N)ncnc1-2)C1CCNCC1 |
| InChI | InChI=1S/C21H26N4/c1-13(14-6-8-23-9-7-14)15-4-5-17-16(10-15)11-21(2,3)18-19(17)24-12-25-20(18)22/h4-5,10,12,14,23H,1,6-9,11H2,2-3H3,(H2,22,24,25) |
| InChIKey | CFHXHGOVQUZDEY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |