C30H52O9S — CID 134817620
2-[2-[2-[2-[(2R)-1-(oxan-2-yloxy)decan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 134817620) has the molecular formula C30H52O9S and a molecular weight of 588.80 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2R)-1-(oxan-2-yloxy)decan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[2-[(2R)-1-(oxan-2-yloxy)decan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134817620 |
| Molecular Formula | C30H52O9S |
| Molecular Weight | 588.80 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 2-[2-[2-[2-[(2R)-1-(oxan-2-yloxy)decan-2-yl]oxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | CCCCCCCC[C@H](COC1CCCCO1)OCCOCCOCCOCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H52O9S/c1-3-4-5-6-7-8-11-28(26-38-30-12-9-10-17-37-30)36-24-22-34-20-18-33-19-21-35-23-25-39-40(31,32)29-15-13-27(2)14-16-29/h13-16,28,30H,3-12,17-26H2,1-2H3/t28-,30?/m1/s1 |
| InChIKey | DBQCWKKQBCGGFQ-KFMIKNBQSA-N |
| XLogP | 5.43 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.80 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|