C24H34F3N7O3 — CID 134819621
3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(1,1,1-trifluoro-2-hydroxypropan-2-yl)purin-2-yl]-1,2,4-oxadiazolidin-5-one (PubChem CID 134819621) has the molecular formula C24H34F3N7O3 and a molecular weight of 525.58 g/mol. Its IUPAC name is 3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(1,1,1-trifluoro-2-hydroxypropan-2-yl)purin-2-yl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(1,1,1-trifluoro-2-hydroxypropan-2-yl)purin-2-yl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 134819621 |
| Molecular Formula | C24H34F3N7O3 |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-(1,1,1-trifluoro-2-hydroxypropan-2-yl)purin-2-yl]-1,2,4-oxadiazolidin-5-one |
| SMILES | CC1CCC(Cn2c(C(C)(O)C(F)(F)F)nc3nc(C4NOC(=O)N4)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C24H34F3N7O3/c1-12-7-9-14(10-8-12)11-34-16-17(28-13(2)15-5-4-6-15)29-19(20-32-22(35)37-33-20)30-18(16)31-21(34)23(3,36)24(25,26)27/h12-15,20,33,36H,4-11H2,1-3H3,(H,32,35)(H,28,29,30)/t12?,13-,14?,20?,23?/m1/s1 |
| InChIKey | VXCKUKSCCJJUCU-LTCCKSBSSA-N |
| XLogP | 4.27 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |