C12H15N3O5S — CID 134820192
2-[[(2R)-2-azaniumyl-3-[(4-nitrophenyl)methylsulfanyl]propanoyl]amino]acetate (PubChem CID 134820192) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[[(2R)-2-azaniumyl-3-[(4-nitrophenyl)methylsulfanyl]propanoyl]amino]acetate.
| Compound Name | 2-[[(2R)-2-azaniumyl-3-[(4-nitrophenyl)methylsulfanyl]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 134820192 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[[(2R)-2-azaniumyl-3-[(4-nitrophenyl)methylsulfanyl]propanoyl]amino]acetate |
| SMILES | [NH3+][C@@H](CSCc1ccc([N+](=O)[O-])cc1)C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C12H15N3O5S/c13-10(12(18)14-5-11(16)17)7-21-6-8-1-3-9(4-2-8)15(19)20/h1-4,10H,5-7,13H2,(H,14,18)(H,16,17)/t10-/m0/s1 |
| InChIKey | VGLAKOFUCVFYSO-JTQLQIEISA-N |
| XLogP | -1.70 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|