C17H15NO4S — CID 134820719
5-(3-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-1,3-oxazole (PubChem CID 134820719) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-1,3-oxazole.
| Compound Name | 5-(3-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-1,3-oxazole |
|---|---|
| PubChem CID | 134820719 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 5-(3-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-1,3-oxazole |
| SMILES | COc1cccc(-c2ocnc2S(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C17H15NO4S/c1-12-6-8-15(9-7-12)23(19,20)17-16(22-11-18-17)13-4-3-5-14(10-13)21-2/h3-11H,1-2H3 |
| InChIKey | RFDPDTDZOIRSJX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |