C20H22INO — CID 134821126
4-(1-benzylquinolin-1-ium-3-yl)butan-1-ol iodide (PubChem CID 134821126) has the molecular formula C20H22INO and a molecular weight of 419.31 g/mol. Its IUPAC name is 4-(1-benzylquinolin-1-ium-3-yl)butan-1-ol iodide.
| Compound Name | 4-(1-benzylquinolin-1-ium-3-yl)butan-1-ol iodide |
|---|---|
| PubChem CID | 134821126 |
| Molecular Formula | C20H22INO |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 4-(1-benzylquinolin-1-ium-3-yl)butan-1-ol iodide |
| SMILES | OCCCCc1cc2ccccc2[n+](Cc2ccccc2)c1.[I-] |
| InChI | InChI=1S/C20H22NO.HI/c22-13-7-6-10-18-14-19-11-4-5-12-20(19)21(16-18)15-17-8-2-1-3-9-17;/h1-5,8-9,11-12,14,16,22H,6-7,10,13,15H2;1H/q+1;/p-1 |
| InChIKey | KSECOFNIAQVTNQ-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|