C49H53N3O3S3 — CID 134822613
5-[5-[1-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 134822613) has the molecular formula C49H53N3O3S3 and a molecular weight of 828.18 g/mol. Its IUPAC name is 5-[5-[1-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[5-[1-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 134822613 |
| Molecular Formula | C49H53N3O3S3 |
| Molecular Weight | 828.18 g/mol |
| Exact Mass | 827.32 |
| IUPAC Name | 5-[5-[1-[5-(9-ethylcarbazol-3-yl)thiophen-2-yl]-2,5-bis(2-ethylhexyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ccc(-c4ccc(C=O)s4)s3)N(CC(CC)CCCC)C(=O)C2=C1c1ccc(-c2ccc3c(c2)c2ccccc2n3CC)s1 |
| InChI | InChI=1S/C49H53N3O3S3/c1-6-11-15-31(8-3)28-51-46(42-25-23-39(57-42)33-19-21-38-36(27-33)35-17-13-14-18-37(35)50(38)10-5)44-45(49(51)55)47(52(48(44)54)29-32(9-4)16-12-7-2)43-26-24-41(58-43)40-22-20-34(30-53)56-40/h13-14,17-27,30-32H,6-12,15-16,28-29H2,1-5H3 |
| InChIKey | ONQMBNIMWZVGNC-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.18 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|