C22H31N7O2 — CID 134823007
(2S,6R)-4-[6-[5-(6-methoxypyrazin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2,6-dimethylmorpholine (PubChem CID 134823007) has the molecular formula C22H31N7O2 and a molecular weight of 425.54 g/mol. Its IUPAC name is (2S,6R)-4-[6-[5-(6-methoxypyrazin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[6-[5-(6-methoxypyrazin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 134823007 |
| Molecular Formula | C22H31N7O2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (2S,6R)-4-[6-[5-(6-methoxypyrazin-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]pyrimidin-4-yl]-2,6-dimethylmorpholine |
| SMILES | COc1cncc(C2CCC3NNC(c4cc(N5C[C@@H](C)O[C@@H](C)C5)ncn4)C3C2)n1 |
| InChI | InChI=1S/C22H31N7O2/c1-13-10-29(11-14(2)31-13)20-7-18(24-12-25-20)22-16-6-15(4-5-17(16)27-28-22)19-8-23-9-21(26-19)30-3/h7-9,12-17,22,27-28H,4-6,10-11H2,1-3H3/t13-,14+,15?,16?,17?,22? |
| InChIKey | LZYGELHEVZIRQY-HWTMRPIDSA-N |
| XLogP | 1.99 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |