C24H42NO12P — CID 134824405
[(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[decoxy(hydroxy)phosphoryl]oxyoxan-2-yl]methyl acetate (PubChem CID 134824405) has the molecular formula C24H42NO12P and a molecular weight of 567.57 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[decoxy(hydroxy)phosphoryl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[decoxy(hydroxy)phosphoryl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134824405 |
| Molecular Formula | C24H42NO12P |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | [(2R,3S,4R,5R)-5-acetamido-3,4-diacetyloxy-6-[decoxy(hydroxy)phosphoryl]oxyoxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCCCOP(=O)(O)OC1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C24H42NO12P/c1-6-7-8-9-10-11-12-13-14-33-38(30,31)37-24-21(25-16(2)26)23(35-19(5)29)22(34-18(4)28)20(36-24)15-32-17(3)27/h20-24H,6-15H2,1-5H3,(H,25,26)(H,30,31)/t20-,21-,22-,23-,24?/m1/s1 |
| InChIKey | UZJYNOQKGVMFNA-ZVCDOGERSA-N |
| XLogP | 2.92 |
| TPSA | 172.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|