C26H31N3O6 — CID 134827096
benzyl N-[(2S)-1-[[(2S)-1-[[(2S)-3,4-dioxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 134827096) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(2S)-1-[[(2S)-3,4-dioxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(2S)-1-[[(2S)-3,4-dioxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 134827096 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | benzyl N-[(2S)-1-[[(2S)-1-[[(2S)-3,4-dioxobutan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](C)C(=O)C=O |
| InChI | InChI=1S/C26H31N3O6/c1-17(2)23(29-26(34)35-16-20-12-8-5-9-13-20)25(33)28-21(14-19-10-6-4-7-11-19)24(32)27-18(3)22(31)15-30/h4-13,15,17-18,21,23H,14,16H2,1-3H3,(H,27,32)(H,28,33)(H,29,34)/t18-,21-,23-/m0/s1 |
| InChIKey | GNXXUHBOVCCJNW-HARLFGEKSA-N |
| XLogP | 1.94 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|