C10H17F4NOSi — CID 134827885
2,2,2-trifluoro-1-[(3S,4R)-3-fluoro-4-trimethylsilylpiperidin-1-yl]ethanone (PubChem CID 134827885) has the molecular formula C10H17F4NOSi and a molecular weight of 271.33 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(3S,4R)-3-fluoro-4-trimethylsilylpiperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(3S,4R)-3-fluoro-4-trimethylsilylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 134827885 |
| Molecular Formula | C10H17F4NOSi |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2,2,2-trifluoro-1-[(3S,4R)-3-fluoro-4-trimethylsilylpiperidin-1-yl]ethanone |
| SMILES | C[Si](C)(C)[C@@H]1CCN(C(=O)C(F)(F)F)C[C@@H]1F |
| InChI | InChI=1S/C10H17F4NOSi/c1-17(2,3)8-4-5-15(6-7(8)11)9(16)10(12,13)14/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | JIDLUAAEJBWVKF-JGVFFNPUSA-N |
| XLogP | 2.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|