C24H36N6O5 — CID 134828988
1-[[(8R,11R,12S)-8,11-dimethyl-5-oxo-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-12-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea (PubChem CID 134828988) has the molecular formula C24H36N6O5 and a molecular weight of 488.59 g/mol. Its IUPAC name is 1-[[(8R,11R,12S)-8,11-dimethyl-5-oxo-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-12-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea.
| Compound Name | 1-[[(8R,11R,12S)-8,11-dimethyl-5-oxo-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-12-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea |
|---|---|
| PubChem CID | 134828988 |
| Molecular Formula | C24H36N6O5 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1-[[(8R,11R,12S)-8,11-dimethyl-5-oxo-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-12-yl]methyl]-3-(4-methoxyphenyl)-1-methylurea |
| SMILES | COc1ccc(NC(=O)N(C)C[C@H]2OCc3cn(nn3)CCCC(=O)OC[C@@H](C)NC[C@H]2C)cc1 |
| InChI | InChI=1S/C24H36N6O5/c1-17-12-25-18(2)15-35-23(31)6-5-11-30-13-20(27-28-30)16-34-22(17)14-29(3)24(32)26-19-7-9-21(33-4)10-8-19/h7-10,13,17-18,22,25H,5-6,11-12,14-16H2,1-4H3,(H,26,32)/t17-,18-,22-/m1/s1 |
| InChIKey | XXQAKNBBVIYKSL-JBYIUTFZSA-N |
| XLogP | 2.29 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |