C22H34N6O3 — CID 134829001
(8R,11S,12R)-8,11-dimethyl-12-[[methyl(pyridin-3-ylmethyl)amino]methyl]-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-5-one (PubChem CID 134829001) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is (8R,11S,12R)-8,11-dimethyl-12-[[methyl(pyridin-3-ylmethyl)amino]methyl]-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-5-one.
| Compound Name | (8R,11S,12R)-8,11-dimethyl-12-[[methyl(pyridin-3-ylmethyl)amino]methyl]-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-5-one |
|---|---|
| PubChem CID | 134829001 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | (8R,11S,12R)-8,11-dimethyl-12-[[methyl(pyridin-3-ylmethyl)amino]methyl]-6,13-dioxa-1,9,16,17-tetrazabicyclo[13.2.1]octadeca-15(18),16-dien-5-one |
| SMILES | C[C@@H]1COC(=O)CCCn2cc(nn2)CO[C@@H](CN(C)Cc2cccnc2)[C@@H](C)CN1 |
| InChI | InChI=1S/C22H34N6O3/c1-17-10-24-18(2)15-31-22(29)7-5-9-28-13-20(25-26-28)16-30-21(17)14-27(3)12-19-6-4-8-23-11-19/h4,6,8,11,13,17-18,21,24H,5,7,9-10,12,14-16H2,1-3H3/t17-,18+,21-/m0/s1 |
| InChIKey | KUAVRJZUNQDQRS-UEXGIBASSA-N |
| XLogP | 1.64 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |