C23H38N4O6S — CID 134829321
(4R,7R,8S)-15-(ethylsulfonylamino)-8-methoxy-4,7,10-trimethyl-11-oxo-N-propyl-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxamide (PubChem CID 134829321) has the molecular formula C23H38N4O6S and a molecular weight of 498.65 g/mol. Its IUPAC name is (4R,7R,8S)-15-(ethylsulfonylamino)-8-methoxy-4,7,10-trimethyl-11-oxo-N-propyl-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxamide.
| Compound Name | (4R,7R,8S)-15-(ethylsulfonylamino)-8-methoxy-4,7,10-trimethyl-11-oxo-N-propyl-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxamide |
|---|---|
| PubChem CID | 134829321 |
| Molecular Formula | C23H38N4O6S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | (4R,7R,8S)-15-(ethylsulfonylamino)-8-methoxy-4,7,10-trimethyl-11-oxo-N-propyl-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carboxamide |
| SMILES | CCCNC(=O)N1C[C@@H](C)[C@H](OC)CN(C)C(=O)c2ccc(NS(=O)(=O)CC)cc2OC[C@H]1C |
| InChI | InChI=1S/C23H38N4O6S/c1-7-11-24-23(29)27-13-16(3)21(32-6)14-26(5)22(28)19-10-9-18(25-34(30,31)8-2)12-20(19)33-15-17(27)4/h9-10,12,16-17,21,25H,7-8,11,13-15H2,1-6H3,(H,24,29)/t16-,17-,21-/m1/s1 |
| InChIKey | VXYRSNUFNCOGCV-CBGDNZLLSA-N |
| XLogP | 2.37 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |