C21H33N3O6S — CID 54633461
N-[(4S,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide (PubChem CID 54633461) has the molecular formula C21H33N3O6S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[(4S,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide.
| Compound Name | N-[(4S,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 54633461 |
| Molecular Formula | C21H33N3O6S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[(4S,7R,8R)-5-acetyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc2c(c1)C(=O)N(C)C[C@H](OC)[C@H](C)CN(C(C)=O)[C@@H](C)CO2 |
| InChI | InChI=1S/C21H33N3O6S/c1-7-31(27,28)22-17-8-9-19-18(10-17)21(26)23(5)12-20(29-6)14(2)11-24(16(4)25)15(3)13-30-19/h8-10,14-15,20,22H,7,11-13H2,1-6H3/t14-,15+,20+/m1/s1 |
| InChIKey | IQGWQEXQBGDRAI-SIFCLUCFSA-N |
| XLogP | 1.80 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |