C22H32F3N3O4 — CID 134829368
N-[(4R,7R,8S)-5-ethyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3,3,3-trifluoropropanamide (PubChem CID 134829368) has the molecular formula C22H32F3N3O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-[(4R,7R,8S)-5-ethyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[(4R,7R,8S)-5-ethyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 134829368 |
| Molecular Formula | C22H32F3N3O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-[(4R,7R,8S)-5-ethyl-8-methoxy-4,7,10-trimethyl-11-oxo-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]-3,3,3-trifluoropropanamide |
| SMILES | CCN1C[C@@H](C)[C@H](OC)CN(C)C(=O)c2cc(NC(=O)CC(F)(F)F)ccc2OC[C@H]1C |
| InChI | InChI=1S/C22H32F3N3O4/c1-6-28-11-14(2)19(31-5)12-27(4)21(30)17-9-16(26-20(29)10-22(23,24)25)7-8-18(17)32-13-15(28)3/h7-9,14-15,19H,6,10-13H2,1-5H3,(H,26,29)/t14-,15-,19-/m1/s1 |
| InChIKey | HZOLNIAKLKJYLV-SPYBWZPUSA-N |
| XLogP | 3.40 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |