C23H34F3N3O4 — CID 54635430
N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(3,3,3-trifluoropropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide (PubChem CID 54635430) has the molecular formula C23H34F3N3O4 and a molecular weight of 473.54 g/mol. Its IUPAC name is N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(3,3,3-trifluoropropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide.
| Compound Name | N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(3,3,3-trifluoropropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide |
|---|---|
| PubChem CID | 54635430 |
| Molecular Formula | C23H34F3N3O4 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | N-[(4R,7S,8R)-8-methoxy-4,7,10-trimethyl-11-oxo-5-(3,3,3-trifluoropropyl)-2-oxa-5,10-diazabicyclo[10.4.0]hexadeca-1(12),13,15-trien-14-yl]propanamide |
| SMILES | CCC(=O)Nc1ccc2c(c1)C(=O)N(C)C[C@H](OC)[C@@H](C)CN(CCC(F)(F)F)[C@H](C)CO2 |
| InChI | InChI=1S/C23H34F3N3O4/c1-6-21(30)27-17-7-8-19-18(11-17)22(31)28(4)13-20(32-5)15(2)12-29(16(3)14-33-19)10-9-23(24,25)26/h7-8,11,15-16,20H,6,9-10,12-14H2,1-5H3,(H,27,30)/t15-,16+,20-/m0/s1 |
| InChIKey | VMAZOCGVITXYGE-YRNRMSPPSA-N |
| XLogP | 3.79 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |