C26H31N3O6 — CID 134830299
2-[(2R,4aS,12aS)-8-acetamido-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 134830299) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is 2-[(2R,4aS,12aS)-8-acetamido-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(2R,4aS,12aS)-8-acetamido-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 134830299 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 2-[(2R,4aS,12aS)-8-acetamido-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)C[C@H]2CC[C@H]3[C@@H](COc4ccc(NC(C)=O)cc4C(=O)N3C)O2)cc1 |
| InChI | InChI=1S/C26H31N3O6/c1-16(30)28-18-6-11-23-21(12-18)26(32)29(2)22-10-9-20(35-24(22)15-34-23)13-25(31)27-14-17-4-7-19(33-3)8-5-17/h4-8,11-12,20,22,24H,9-10,13-15H2,1-3H3,(H,27,31)(H,28,30)/t20-,22+,24-/m1/s1 |
| InChIKey | LMXYUGNLGIKXGE-JCTONOIOSA-N |
| XLogP | 2.74 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |