C26H30FN3O6 — CID 54656161
2-[(2S,4aS,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 54656161) has the molecular formula C26H30FN3O6 and a molecular weight of 499.54 g/mol. Its IUPAC name is 2-[(2S,4aS,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(2S,4aS,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 54656161 |
| Molecular Formula | C26H30FN3O6 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[(2S,4aS,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | COCC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@H]1CC[C@@H](CC(=O)NCc3cccc(F)c3)O[C@@H]1CO2 |
| InChI | InChI=1S/C26H30FN3O6/c1-30-21-8-7-19(12-24(31)28-13-16-4-3-5-17(27)10-16)36-23(21)14-35-22-9-6-18(11-20(22)26(30)33)29-25(32)15-34-2/h3-6,9-11,19,21,23H,7-8,12-15H2,1-2H3,(H,28,31)(H,29,32)/t19-,21-,23+/m0/s1 |
| InChIKey | HJQSVKALTDKVGX-IEIRFRATSA-N |
| XLogP | 2.50 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |