C26H37N3O6 — CID 54654957
2-[(2R,4aS,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 54654957) has the molecular formula C26H37N3O6 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-[(2R,4aS,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(2R,4aS,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 54654957 |
| Molecular Formula | C26H37N3O6 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | 2-[(2R,4aS,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | COCC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@H]1CC[C@H](CC(=O)NCC3CCCCC3)O[C@H]1CO2 |
| InChI | InChI=1S/C26H37N3O6/c1-29-21-10-9-19(13-24(30)27-14-17-6-4-3-5-7-17)35-23(21)15-34-22-11-8-18(12-20(22)26(29)32)28-25(31)16-33-2/h8,11-12,17,19,21,23H,3-7,9-10,13-16H2,1-2H3,(H,27,30)(H,28,31)/t19-,21+,23+/m1/s1 |
| InChIKey | BKCWCNYQTBLYDV-NWSQWKLXSA-N |
| XLogP | 2.74 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |