C22H31N3O6 — CID 54656142
2-[(2R,4aR,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-propylacetamide (PubChem CID 54656142) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-[(2R,4aR,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-propylacetamide.
| Compound Name | 2-[(2R,4aR,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 54656142 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-[(2R,4aR,12aS)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)C[C@H]1CC[C@@H]2[C@@H](COc3ccc(NC(=O)COC)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C22H31N3O6/c1-4-9-23-20(26)11-15-6-7-17-19(31-15)12-30-18-8-5-14(24-21(27)13-29-3)10-16(18)22(28)25(17)2/h5,8,10,15,17,19H,4,6-7,9,11-13H2,1-3H3,(H,23,26)(H,24,27)/t15-,17-,19-/m1/s1 |
| InChIKey | HADOMIFGGLYOPR-SZVBFZGTSA-N |
| XLogP | 1.57 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |