C23H33N3O6 — CID 54655820
N-[(2R,4aS,12aS)-2-[2-(2-methoxyethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide (PubChem CID 54655820) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is N-[(2R,4aS,12aS)-2-[2-(2-methoxyethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide.
| Compound Name | N-[(2R,4aS,12aS)-2-[2-(2-methoxyethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
|---|---|
| PubChem CID | 54655820 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[(2R,4aS,12aS)-2-[2-(2-methoxyethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@H]1CC[C@H](CC(=O)NCCOC)O[C@@H]1CO2 |
| InChI | InChI=1S/C23H33N3O6/c1-4-5-21(27)25-15-6-9-19-17(12-15)23(29)26(2)18-8-7-16(32-20(18)14-31-19)13-22(28)24-10-11-30-3/h6,9,12,16,18,20H,4-5,7-8,10-11,13-14H2,1-3H3,(H,24,28)(H,25,27)/t16-,18+,20-/m1/s1 |
| InChIKey | MZWHGDJVVCYRFN-IMFGXOCKSA-N |
| XLogP | 1.96 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|