C25H38N4O5 — CID 54656276
N-[(2S,4aR,12aR)-2-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide (PubChem CID 54656276) has the molecular formula C25H38N4O5 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-[(2S,4aR,12aR)-2-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide.
| Compound Name | N-[(2S,4aR,12aR)-2-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
|---|---|
| PubChem CID | 54656276 |
| Molecular Formula | C25H38N4O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | N-[(2S,4aR,12aR)-2-[2-[3-(dimethylamino)propylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@@H]1CC[C@@H](CC(=O)NCCCN(C)C)O[C@H]1CO2 |
| InChI | InChI=1S/C25H38N4O5/c1-5-7-23(30)27-17-8-11-21-19(14-17)25(32)29(4)20-10-9-18(34-22(20)16-33-21)15-24(31)26-12-6-13-28(2)3/h8,11,14,18,20,22H,5-7,9-10,12-13,15-16H2,1-4H3,(H,26,31)(H,27,30)/t18-,20+,22-/m0/s1 |
| InChIKey | WLLMLOSTZXXUJY-DWLFOUALSA-N |
| XLogP | 2.26 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|