C27H34N4O5 — CID 54657243
N-[(2R,4aR,12aS)-5-methyl-6-oxo-2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide (PubChem CID 54657243) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is N-[(2R,4aR,12aS)-5-methyl-6-oxo-2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide.
| Compound Name | N-[(2R,4aR,12aS)-5-methyl-6-oxo-2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
|---|---|
| PubChem CID | 54657243 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | N-[(2R,4aR,12aS)-5-methyl-6-oxo-2-[2-oxo-2-(2-pyridin-4-ylethylamino)ethyl]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@@H]1CC[C@H](CC(=O)NCCc3ccncc3)O[C@@H]1CO2 |
| InChI | InChI=1S/C27H34N4O5/c1-3-4-25(32)30-19-5-8-23-21(15-19)27(34)31(2)22-7-6-20(36-24(22)17-35-23)16-26(33)29-14-11-18-9-12-28-13-10-18/h5,8-10,12-13,15,20,22,24H,3-4,6-7,11,14,16-17H2,1-2H3,(H,29,33)(H,30,32)/t20-,22-,24-/m1/s1 |
| InChIKey | VNMIAHPUAYTVKQ-KIFXHHALSA-N |
| XLogP | 2.95 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |