C22H31N3O7 — CID 54656997
2-[(2S,4aR,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 54656997) has the molecular formula C22H31N3O7 and a molecular weight of 449.50 g/mol. Its IUPAC name is 2-[(2S,4aR,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2S,4aR,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 54656997 |
| Molecular Formula | C22H31N3O7 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-[(2S,4aR,12aR)-8-[(2-methoxyacetyl)amino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1CC[C@@H]2[C@H](COc3ccc(NC(=O)COC)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C22H31N3O7/c1-25-17-6-5-15(11-20(26)23-8-9-29-2)32-19(17)12-31-18-7-4-14(10-16(18)22(25)28)24-21(27)13-30-3/h4,7,10,15,17,19H,5-6,8-9,11-13H2,1-3H3,(H,23,26)(H,24,27)/t15-,17+,19-/m0/s1 |
| InChIKey | NBNHDXFFIQEMGP-WDYCEAGBSA-N |
| XLogP | 0.80 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|