C26H32N4O6 — CID 54656611
2-[(2R,4aS,12aR)-5-methyl-6-oxo-8-(phenylcarbamoylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 54656611) has the molecular formula C26H32N4O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is 2-[(2R,4aS,12aR)-5-methyl-6-oxo-8-(phenylcarbamoylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2R,4aS,12aR)-5-methyl-6-oxo-8-(phenylcarbamoylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 54656611 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 2-[(2R,4aS,12aR)-5-methyl-6-oxo-8-(phenylcarbamoylamino)-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@H]1CC[C@H]2[C@H](COc3ccc(NC(=O)Nc4ccccc4)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C26H32N4O6/c1-30-21-10-9-19(15-24(31)27-12-13-34-2)36-23(21)16-35-22-11-8-18(14-20(22)25(30)32)29-26(33)28-17-6-4-3-5-7-17/h3-8,11,14,19,21,23H,9-10,12-13,15-16H2,1-2H3,(H,27,31)(H2,28,29,33)/t19-,21+,23+/m1/s1 |
| InChIKey | OSYQMFUNWKBWRP-NWSQWKLXSA-N |
| XLogP | 2.86 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|