C22H32N4O6 — CID 54655285
2-[(2R,4aR,12aR)-8-(ethylcarbamoylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 54655285) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[(2R,4aR,12aR)-8-(ethylcarbamoylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2R,4aR,12aR)-8-(ethylcarbamoylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 54655285 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 2-[(2R,4aR,12aR)-8-(ethylcarbamoylamino)-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCNC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@@H]1CC[C@H](CC(=O)NCCOC)O[C@H]1CO2 |
| InChI | InChI=1S/C22H32N4O6/c1-4-23-22(29)25-14-5-8-18-16(11-14)21(28)26(2)17-7-6-15(32-19(17)13-31-18)12-20(27)24-9-10-30-3/h5,8,11,15,17,19H,4,6-7,9-10,12-13H2,1-3H3,(H,24,27)(H2,23,25,29)/t15-,17-,19+/m1/s1 |
| InChIKey | GZKDPSMCKMHZSQ-SUMDDJOVSA-N |
| XLogP | 1.36 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|