C29H37N3O5S — CID 54654794
2-[(2R,4aR,12aR)-5-methyl-6-oxo-8-[(2-thiophen-2-ylacetyl)amino]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide (PubChem CID 54654794) has the molecular formula C29H37N3O5S and a molecular weight of 539.70 g/mol. Its IUPAC name is 2-[(2R,4aR,12aR)-5-methyl-6-oxo-8-[(2-thiophen-2-ylacetyl)amino]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[(2R,4aR,12aR)-5-methyl-6-oxo-8-[(2-thiophen-2-ylacetyl)amino]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 54654794 |
| Molecular Formula | C29H37N3O5S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-[(2R,4aR,12aR)-5-methyl-6-oxo-8-[(2-thiophen-2-ylacetyl)amino]-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(cyclohexylmethyl)acetamide |
| SMILES | CN1C(=O)c2cc(NC(=O)Cc3cccs3)ccc2OC[C@@H]2O[C@@H](CC(=O)NCC3CCCCC3)CC[C@H]21 |
| InChI | InChI=1S/C29H37N3O5S/c1-32-24-11-10-21(15-27(33)30-17-19-6-3-2-4-7-19)37-26(24)18-36-25-12-9-20(14-23(25)29(32)35)31-28(34)16-22-8-5-13-38-22/h5,8-9,12-14,19,21,24,26H,2-4,6-7,10-11,15-18H2,1H3,(H,30,33)(H,31,34)/t21-,24-,26+/m1/s1 |
| InChIKey | ZXVFSIFYNPKTTN-QQSVUBKYSA-N |
| XLogP | 4.40 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |