C30H36FN3O5 — CID 54657452
N-[(2S,4aR,12aS)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-4-fluorobenzamide (PubChem CID 54657452) has the molecular formula C30H36FN3O5 and a molecular weight of 537.63 g/mol. Its IUPAC name is N-[(2S,4aR,12aS)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S,4aR,12aS)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 54657452 |
| Molecular Formula | C30H36FN3O5 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N-[(2S,4aR,12aS)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-4-fluorobenzamide |
| SMILES | CN1C(=O)c2cc(NC(=O)c3ccc(F)cc3)ccc2OC[C@H]2O[C@H](CC(=O)NCC3CCCCC3)CC[C@H]21 |
| InChI | InChI=1S/C30H36FN3O5/c1-34-25-13-12-23(16-28(35)32-17-19-5-3-2-4-6-19)39-27(25)18-38-26-14-11-22(15-24(26)30(34)37)33-29(36)20-7-9-21(31)10-8-20/h7-11,14-15,19,23,25,27H,2-6,12-13,16-18H2,1H3,(H,32,35)(H,33,36)/t23-,25+,27+/m0/s1 |
| InChIKey | PMRLUOSHFFSWPW-VXQMPNGUSA-N |
| XLogP | 4.55 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |