C27H32FN3O5 — CID 54655840
N-[(2S,4aS,12aR)-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-2-methylpropanamide (PubChem CID 54655840) has the molecular formula C27H32FN3O5 and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[(2S,4aS,12aR)-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-2-methylpropanamide.
| Compound Name | N-[(2S,4aS,12aR)-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 54655840 |
| Molecular Formula | C27H32FN3O5 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-[(2S,4aS,12aR)-2-[2-[(3-fluorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1ccc2c(c1)C(=O)N(C)[C@H]1CC[C@@H](CC(=O)NCc3cccc(F)c3)O[C@H]1CO2 |
| InChI | InChI=1S/C27H32FN3O5/c1-16(2)26(33)30-19-7-10-23-21(12-19)27(34)31(3)22-9-8-20(36-24(22)15-35-23)13-25(32)29-14-17-5-4-6-18(28)11-17/h4-7,10-12,16,20,22,24H,8-9,13-15H2,1-3H3,(H,29,32)(H,30,33)/t20-,22-,24-/m0/s1 |
| InChIKey | QGPGDZBDPLAGRD-SSPYTLHUSA-N |
| XLogP | 3.51 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |