C30H29ClFN3O5 — CID 54654713
N-[(2R,4aR,12aS)-2-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-3-fluorobenzamide (PubChem CID 54654713) has the molecular formula C30H29ClFN3O5 and a molecular weight of 566.03 g/mol. Its IUPAC name is N-[(2R,4aR,12aS)-2-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-3-fluorobenzamide.
| Compound Name | N-[(2R,4aR,12aS)-2-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 54654713 |
| Molecular Formula | C30H29ClFN3O5 |
| Molecular Weight | 566.03 g/mol |
| Exact Mass | 565.18 |
| IUPAC Name | N-[(2R,4aR,12aS)-2-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-8-yl]-3-fluorobenzamide |
| SMILES | CN1C(=O)c2cc(NC(=O)c3cccc(F)c3)ccc2OC[C@H]2O[C@@H](CC(=O)NCc3ccccc3Cl)CC[C@H]21 |
| InChI | InChI=1S/C30H29ClFN3O5/c1-35-25-11-10-22(15-28(36)33-16-19-5-2-3-8-24(19)31)40-27(25)17-39-26-12-9-21(14-23(26)30(35)38)34-29(37)18-6-4-7-20(32)13-18/h2-9,12-14,22,25,27H,10-11,15-17H2,1H3,(H,33,36)(H,34,37)/t22-,25-,27-/m1/s1 |
| InChIKey | QJOFZOVLVPEXCW-AVPJRLCVSA-N |
| XLogP | 4.82 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.03 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |