C26H25NO4 — CID 134830569
(4R)-4-benzyl-3-[3-(4-phenylmethoxyphenyl)propanoyl]-1,3-oxazolidin-2-one (PubChem CID 134830569) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[3-(4-phenylmethoxyphenyl)propanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[3-(4-phenylmethoxyphenyl)propanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134830569 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (4R)-4-benzyl-3-[3-(4-phenylmethoxyphenyl)propanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CCc1ccc(OCc2ccccc2)cc1)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H25NO4/c28-25(27-23(19-31-26(27)29)17-21-7-3-1-4-8-21)16-13-20-11-14-24(15-12-20)30-18-22-9-5-2-6-10-22/h1-12,14-15,23H,13,16-19H2/t23-/m1/s1 |
| InChIKey | ABKKGYBGPZDODV-HSZRJFAPSA-N |
| XLogP | 4.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |