C19H19NO2 — CID 134830796
[(R)-phenyl(2,3,4,5-tetrahydropyridin-6-yl)methyl] benzoate (PubChem CID 134830796) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is [(R)-phenyl(2,3,4,5-tetrahydropyridin-6-yl)methyl] benzoate.
| Compound Name | [(R)-phenyl(2,3,4,5-tetrahydropyridin-6-yl)methyl] benzoate |
|---|---|
| PubChem CID | 134830796 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | [(R)-phenyl(2,3,4,5-tetrahydropyridin-6-yl)methyl] benzoate |
| SMILES | O=C(O[C@@H](C1=NCCCC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c21-19(16-11-5-2-6-12-16)22-18(15-9-3-1-4-10-15)17-13-7-8-14-20-17/h1-6,9-12,18H,7-8,13-14H2/t18-/m1/s1 |
| InChIKey | UOYKTJXWWOKNLK-GOSISDBHSA-N |
| XLogP | 4.21 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |