C31H23N4PS — CID 134831398
N-phenyl-1-[7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazin-6-yl]methanimine (PubChem CID 134831398) has the molecular formula C31H23N4PS and a molecular weight of 514.59 g/mol. Its IUPAC name is N-phenyl-1-[7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazin-6-yl]methanimine.
| Compound Name | N-phenyl-1-[7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazin-6-yl]methanimine |
|---|---|
| PubChem CID | 134831398 |
| Molecular Formula | C31H23N4PS |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | N-phenyl-1-[7-[(triphenyl-λ5-phosphanylidene)amino]thieno[2,3-b]pyrazin-6-yl]methanimine |
| SMILES | C(=N\c1ccccc1)\c1sc2nccnc2c1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H23N4PS/c1-5-13-24(14-6-1)34-23-28-29(30-31(37-28)33-22-21-32-30)35-36(25-15-7-2-8-16-25,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-23H/b34-23- |
| InChIKey | LMBXSILPQODLIG-XSVYLIDLSA-N |
| XLogP | 7.25 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|