C27H35NO5 — CID 134831532
(4R)-4-benzyl-3-[(2R,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxyoctanoyl]-1,3-oxazolidin-2-one (PubChem CID 134831532) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxyoctanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxyoctanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134831532 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,4R,5S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxyoctanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H](OCc1ccccc1)[C@H](C)[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C27H35NO5/c1-4-11-24(32-17-22-14-9-6-10-15-22)19(2)25(29)20(3)26(30)28-23(18-33-27(28)31)16-21-12-7-5-8-13-21/h5-10,12-15,19-20,23-25,29H,4,11,16-18H2,1-3H3/t19-,20+,23+,24-,25-/m0/s1 |
| InChIKey | CEOHRGGNKWAWMM-MAOFURFTSA-N |
| XLogP | 4.60 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |