C32H34F3NO6 — CID 134831713
[(Z)-3-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate (PubChem CID 134831713) has the molecular formula C32H34F3NO6 and a molecular weight of 585.62 g/mol. Its IUPAC name is [(Z)-3-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate.
| Compound Name | [(Z)-3-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate |
|---|---|
| PubChem CID | 134831713 |
| Molecular Formula | C32H34F3NO6 |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | [(Z)-3-[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]prop-2-enyl] 2,2,2-trifluoroethanimidate |
| SMILES | [H]/N=C(/OC/C=C\[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C32H34F3NO6/c1-37-30-29(41-22-25-16-9-4-10-17-25)28(40-21-24-14-7-3-8-15-24)27(39-20-23-12-5-2-6-13-23)26(42-30)18-11-19-38-31(36)32(33,34)35/h2-18,26-30,36H,19-22H2,1H3/b18-11-,36-31+/t26-,27-,28+,29-,30+/m1/s1 |
| InChIKey | NMOKTKXBEVTLKM-NYZIQPEBSA-N |
| XLogP | 6.23 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|