C21H38O3Si — CID 134832529
(1R,4S,4aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(hydroxymethyl)-6,6,7b-trimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]inden-4-ol (PubChem CID 134832529) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (1R,4S,4aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(hydroxymethyl)-6,6,7b-trimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]inden-4-ol.
| Compound Name | (1R,4S,4aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(hydroxymethyl)-6,6,7b-trimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]inden-4-ol |
|---|---|
| PubChem CID | 134832529 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (1R,4S,4aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(hydroxymethyl)-6,6,7b-trimethyl-2,4,4a,5,7,7a-hexahydro-1H-cyclobuta[e]inden-4-ol |
| SMILES | CC1(C)C[C@H]2[C@H](O)C(CO)=C3C[C@@H](O[Si](C)(C)C(C)(C)C)C3(C)[C@H]2C1 |
| InChI | InChI=1S/C21H38O3Si/c1-19(2,3)25(7,8)24-17-9-15-14(12-22)18(23)13-10-20(4,5)11-16(13)21(15,17)6/h13,16-18,22-23H,9-12H2,1-8H3/t13-,16+,17-,18+,21?/m1/s1 |
| InChIKey | GILKCOQXMZGBIJ-HUZZRVIKSA-N |
| XLogP | 4.50 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|