C14H19NO3S — CID 134833089
2-[(2S,5S)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]acetaldehyde (PubChem CID 134833089) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[(2S,5S)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,5S)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 134833089 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-[(2S,5S)-5-methyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CC=O)CC[C@@H]2C)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-11-3-7-14(8-4-11)19(17,18)15-12(2)5-6-13(15)9-10-16/h3-4,7-8,10,12-13H,5-6,9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | WFOULPAPHPPJML-STQMWFEESA-N |
| XLogP | 2.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|