C42H33F12N2O+ — CID 134833167
[(2S,5R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol (PubChem CID 134833167) has the molecular formula C42H33F12N2O+ and a molecular weight of 809.72 g/mol. Its IUPAC name is [(2S,5R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol.
| Compound Name | [(2S,5R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
|---|---|
| PubChem CID | 134833167 |
| Molecular Formula | C42H33F12N2O+ |
| Molecular Weight | 809.72 g/mol |
| Exact Mass | 809.24 |
| IUPAC Name | [(2S,5R)-1-[[3,5-bis[3,5-bis(trifluoromethyl)phenyl]phenyl]methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethanol |
| SMILES | C=C[C@H]1C[N+]2(Cc3cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)cc(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c3)CCC1C[C@H]2C(O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C42H33F12N2O/c1-2-24-22-56(10-8-25(24)18-37(56)38(57)35-7-9-55-36-6-4-3-5-34(35)36)21-23-11-26(28-14-30(39(43,44)45)19-31(15-28)40(46,47)48)13-27(12-23)29-16-32(41(49,50)51)20-33(17-29)42(52,53)54/h2-7,9,11-17,19-20,24-25,37-38,57H,1,8,10,18,21-22H2/q+1/t24-,25?,37-,38?,56?/m0/s1 |
| InChIKey | AXCWKOFUQJWXSB-GJMBIVSBSA-N |
| XLogP | 12.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.72 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|