C25H33N2O4 — CID 134833281
CID 134833281 (PubChem CID 134833281) has the molecular formula C25H33N2O4 and a molecular weight of 425.55 g/mol.
| Compound Name | CID 134833281 |
|---|---|
| PubChem CID | 134833281 |
| Molecular Formula | C25H33N2O4 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | — |
| SMILES | [CH2]C(=O)N(CCc1ccc(OC)c(OC)c1)C(C(=O)Nc1c(C)cccc1C)C(C)C |
| InChI | InChI=1S/C25H33N2O4/c1-16(2)24(25(29)26-23-17(3)9-8-10-18(23)4)27(19(5)28)14-13-20-11-12-21(30-6)22(15-20)31-7/h8-12,15-16,24H,5,13-14H2,1-4,6-7H3,(H,26,29) |
| InChIKey | QUHYLQUEWPFCDJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |