About lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate
lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate (PubChem CID 134833557) has the molecular formula C8H6ClLaO2-
and a molecular weight of 308.49 g/mol. Its IUPAC name is lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate.
Molecular Properties
| Compound Name | lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate |
| PubChem CID | 134833557 |
| Molecular Formula | C8H6ClLaO2- |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 307.91 |
| IUPAC Name | lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate |
| SMILES | COC(=O)c1[c-]c(Cl)ccc1.[La] |
| InChI | InChI=1S/C8H6ClO2.La/c1-11-8(10)6-3-2-4-7(9)5-6;/h2-4H,1H3;/q-1; |
| InChIKey | CUDKAXQBMLGABM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate?
The IUPAC name of lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate (CID 134833557) is lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate.
What is the SMILES notation for lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate?
The canonical SMILES for lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate is COC(=O)c1[c-]c(Cl)ccc1.[La].
What is the InChIKey of lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate?
The InChIKey is CUDKAXQBMLGABM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClO2.La/c1-11-8(10)6-3-2-4-7(9)5-6;/h2-4H,1H3;/q-1;.
What are the key properties of lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate?
lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate has a molecular weight of 308.49 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;methyl 3-chlorobenzene-2-ide-1-carboxylate is sourced from PubChem (CID 134833557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).